C12H14Cl2N2O2 — CID 59474105
(3,5-dichlorophenyl)methyl piperazine-1-carboxylate (PubChem CID 59474105) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl piperazine-1-carboxylate.
| Compound Name | (3,5-dichlorophenyl)methyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59474105 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (3,5-dichlorophenyl)methyl piperazine-1-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H14Cl2N2O2/c13-10-5-9(6-11(14)7-10)8-18-12(17)16-3-1-15-2-4-16/h5-7,15H,1-4,8H2 |
| InChIKey | RBPSRPYEBWMAGK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |