About (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate
(4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate (PubChem CID 66720699) has the molecular formula C12H14ClFN2O2
and a molecular weight of 272.71 g/mol. Its IUPAC name is (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate |
| PubChem CID | 66720699 |
| Molecular Formula | C12H14ClFN2O2 |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)c(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H14ClFN2O2/c13-10-2-1-9(7-11(10)14)8-18-12(17)16-5-3-15-4-6-16/h1-2,7,15H,3-6,8H2 |
| InChIKey | CVJQKTSLRXUKGZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate?
The IUPAC name of (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate (CID 66720699) is (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate.
What is the SMILES notation for (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate?
The canonical SMILES for (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate is O=C(OCc1ccc(Cl)c(F)c1)N1CCNCC1.
What is the InChIKey of (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate?
The InChIKey is CVJQKTSLRXUKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClFN2O2/c13-10-2-1-9(7-11(10)14)8-18-12(17)16-5-3-15-4-6-16/h1-2,7,15H,3-6,8H2.
What are the key properties of (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate?
(4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate has a molecular weight of 272.71 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3-fluorophenyl)methyl piperazine-1-carboxylate is sourced from PubChem (CID 66720699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).