C12H13ClF2N2O2 — CID 66720628
(3-chloro-4,5-difluorophenyl)methyl piperazine-1-carboxylate (PubChem CID 66720628) has the molecular formula C12H13ClF2N2O2 and a molecular weight of 290.70 g/mol. Its IUPAC name is (3-chloro-4,5-difluorophenyl)methyl piperazine-1-carboxylate.
| Compound Name | (3-chloro-4,5-difluorophenyl)methyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66720628 |
| Molecular Formula | C12H13ClF2N2O2 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (3-chloro-4,5-difluorophenyl)methyl piperazine-1-carboxylate |
| SMILES | O=C(OCc1cc(F)c(F)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H13ClF2N2O2/c13-9-5-8(6-10(14)11(9)15)7-19-12(18)17-3-1-16-2-4-17/h5-6,16H,1-4,7H2 |
| InChIKey | LXAHQCZBOOIURN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|