C14H24N2 — CID 71040680
N-methyl-N-[(4-methylcyclohexen-1-yl)methyl]-2,3,4,5-tetrahydropyridin-4-amine (PubChem CID 71040680) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-methyl-N-[(4-methylcyclohexen-1-yl)methyl]-2,3,4,5-tetrahydropyridin-4-amine.
| Compound Name | N-methyl-N-[(4-methylcyclohexen-1-yl)methyl]-2,3,4,5-tetrahydropyridin-4-amine |
|---|---|
| PubChem CID | 71040680 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-methyl-N-[(4-methylcyclohexen-1-yl)methyl]-2,3,4,5-tetrahydropyridin-4-amine |
| SMILES | CC1CC=C(CN(C)C2CC=NCC2)CC1 |
| InChI | InChI=1S/C14H24N2/c1-12-3-5-13(6-4-12)11-16(2)14-7-9-15-10-8-14/h5,9,12,14H,3-4,6-8,10-11H2,1-2H3 |
| InChIKey | SQBRZPCOTZUTDT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|