C13H23N2 — CID 156868908
CID 156868908 (PubChem CID 156868908) has the molecular formula C13H23N2 and a molecular weight of 207.34 g/mol.
| Compound Name | CID 156868908 |
|---|---|
| PubChem CID | 156868908 |
| Molecular Formula | C13H23N2 |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | — |
| SMILES | CC1=C[CH]C=NC1C(CN(C)C)C(C)C |
| InChI | InChI=1S/C13H23N2/c1-10(2)12(9-15(4)5)13-11(3)7-6-8-14-13/h6-8,10,12-13H,9H2,1-5H3 |
| InChIKey | BJXQLSRQAXYYSO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |