C11H19N — CID 177116449
2,3-di(propan-2-yl)-2,5-dihydropyridine (PubChem CID 177116449) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-2,5-dihydropyridine.
| Compound Name | 2,3-di(propan-2-yl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 177116449 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2,3-di(propan-2-yl)-2,5-dihydropyridine |
| SMILES | CC(C)C1=CCC=NC1C(C)C |
| InChI | InChI=1S/C11H19N/c1-8(2)10-6-5-7-12-11(10)9(3)4/h6-9,11H,5H2,1-4H3 |
| InChIKey | JHMFJZHHNMIKAW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|