C18H15N3 — CID 71050691
N-(2,3-dihydroquinolin-2-yl)quinolin-2-amine (PubChem CID 71050691) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(2,3-dihydroquinolin-2-yl)quinolin-2-amine.
| Compound Name | N-(2,3-dihydroquinolin-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 71050691 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-(2,3-dihydroquinolin-2-yl)quinolin-2-amine |
| SMILES | C1=c2ccccc2=NC(Nc2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C18H15N3/c1-3-7-15-13(5-1)9-11-17(19-15)21-18-12-10-14-6-2-4-8-16(14)20-18/h1-11,18H,12H2,(H,19,21) |
| InChIKey | SPLMFFNDBOMOPR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |