C24H23ClF3N5O3 — CID 71051049
3-(2-aminopropanoylamino)propyl N-[4-(3-chlorophenyl)pyrimidin-2-yl]-N-[4-(trifluoromethyl)phenyl]carbamate (PubChem CID 71051049) has the molecular formula C24H23ClF3N5O3 and a molecular weight of 521.93 g/mol. Its IUPAC name is 3-(2-aminopropanoylamino)propyl N-[4-(3-chlorophenyl)pyrimidin-2-yl]-N-[4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 3-(2-aminopropanoylamino)propyl N-[4-(3-chlorophenyl)pyrimidin-2-yl]-N-[4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 71051049 |
| Molecular Formula | C24H23ClF3N5O3 |
| Molecular Weight | 521.93 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 3-(2-aminopropanoylamino)propyl N-[4-(3-chlorophenyl)pyrimidin-2-yl]-N-[4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(N)C(=O)NCCCOC(=O)N(c1ccc(C(F)(F)F)cc1)c1nccc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C24H23ClF3N5O3/c1-15(29)21(34)30-11-3-13-36-23(35)33(19-8-6-17(7-9-19)24(26,27)28)22-31-12-10-20(32-22)16-4-2-5-18(25)14-16/h2,4-10,12,14-15H,3,11,13,29H2,1H3,(H,30,34) |
| InChIKey | UEWOWGKLMNWXMP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.93 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|