C22H22ClF3IN3O2S — CID 162457284
2-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamoyl]oxyethyl-trimethylazanium iodide (PubChem CID 162457284) has the molecular formula C22H22ClF3IN3O2S and a molecular weight of 611.86 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamoyl]oxyethyl-trimethylazanium iodide.
| Compound Name | 2-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamoyl]oxyethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 162457284 |
| Molecular Formula | C22H22ClF3IN3O2S |
| Molecular Weight | 611.86 g/mol |
| Exact Mass | 611.01 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamoyl]oxyethyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCOC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(-c2cccc(Cl)c2)cs1.[I-] |
| InChI | InChI=1S/C22H22ClF3N3O2S.HI/c1-29(2,3)10-11-31-21(30)28(18-9-5-7-16(13-18)22(24,25)26)20-27-19(14-32-20)15-6-4-8-17(23)12-15;/h4-9,12-14H,10-11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CCEAZRJVNXASQM-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|