C20H14BrF3N4OS — CID 156518264
3-(2-bromoethyl)-1-[4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-[3-(trifluoromethyl)phenyl]urea (PubChem CID 156518264) has the molecular formula C20H14BrF3N4OS and a molecular weight of 495.32 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-[4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 3-(2-bromoethyl)-1-[4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 156518264 |
| Molecular Formula | C20H14BrF3N4OS |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 3-(2-bromoethyl)-1-[4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-[3-(trifluoromethyl)phenyl]urea |
| SMILES | N#Cc1cccc(-c2csc(N(C(=O)NCCBr)c3cccc(C(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C20H14BrF3N4OS/c21-7-8-26-18(29)28(16-6-2-5-15(10-16)20(22,23)24)19-27-17(12-30-19)14-4-1-3-13(9-14)11-25/h1-6,9-10,12H,7-8H2,(H,26,29) |
| InChIKey | OKWKDNVNPGTMNY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|