C17H9F4N3O4S — CID 166666644
[4-(2-fluoro-5-nitrophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 166666644) has the molecular formula C17H9F4N3O4S and a molecular weight of 427.34 g/mol. Its IUPAC name is [4-(2-fluoro-5-nitrophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [4-(2-fluoro-5-nitrophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 166666644 |
| Molecular Formula | C17H9F4N3O4S |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | [4-(2-fluoro-5-nitrophenyl)-1,3-thiazol-2-yl]-[3-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=C(O)N(c1cccc(C(F)(F)F)c1)c1nc(-c2cc([N+](=O)[O-])ccc2F)cs1 |
| InChI | InChI=1S/C17H9F4N3O4S/c18-13-5-4-11(24(27)28)7-12(13)14-8-29-15(22-14)23(16(25)26)10-3-1-2-9(6-10)17(19,20)21/h1-8H,(H,25,26) |
| InChIKey | IWCRCIRECGXCLV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|