C21H19F4N3O3S — CID 160967673
tert-butyl N-[4-(5-aminooxy-2-fluorophenyl)-1,3-thiazol-2-yl]-N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 160967673) has the molecular formula C21H19F4N3O3S and a molecular weight of 469.46 g/mol. Its IUPAC name is tert-butyl N-[4-(5-aminooxy-2-fluorophenyl)-1,3-thiazol-2-yl]-N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(5-aminooxy-2-fluorophenyl)-1,3-thiazol-2-yl]-N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 160967673 |
| Molecular Formula | C21H19F4N3O3S |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | tert-butyl N-[4-(5-aminooxy-2-fluorophenyl)-1,3-thiazol-2-yl]-N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(-c2cc(ON)ccc2F)cs1 |
| InChI | InChI=1S/C21H19F4N3O3S/c1-20(2,3)30-19(29)28(13-6-4-5-12(9-13)21(23,24)25)18-27-17(11-32-18)15-10-14(31-26)7-8-16(15)22/h4-11H,26H2,1-3H3 |
| InChIKey | RYGNZASTLMXBKP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|