C21H14F4N2O3S — CID 24656471
(4-fluorophenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate (PubChem CID 24656471) has the molecular formula C21H14F4N2O3S and a molecular weight of 450.41 g/mol. Its IUPAC name is (4-fluorophenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate.
| Compound Name | (4-fluorophenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 24656471 |
| Molecular Formula | C21H14F4N2O3S |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | (4-fluorophenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate |
| SMILES | CC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(/C=C/C(=O)Oc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C21H14F4N2O3S/c1-13(28)27(17-4-2-3-14(11-17)21(23,24)25)20-26-16(12-31-20)7-10-19(29)30-18-8-5-15(22)6-9-18/h2-12H,1H3/b10-7+ |
| InChIKey | FYWJACUTIRFHQZ-JXMROGBWSA-N |
| XLogP | 5.60 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|