C22H17F3N4O3S — CID 24513280
3-[[(E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoyl]amino]benzamide (PubChem CID 24513280) has the molecular formula C22H17F3N4O3S and a molecular weight of 474.46 g/mol. Its IUPAC name is 3-[[(E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoyl]amino]benzamide.
| Compound Name | 3-[[(E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 24513280 |
| Molecular Formula | C22H17F3N4O3S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 3-[[(E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoyl]amino]benzamide |
| SMILES | CC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(/C=C/C(=O)Nc2cccc(C(N)=O)c2)cs1 |
| InChI | InChI=1S/C22H17F3N4O3S/c1-13(30)29(18-7-3-5-15(11-18)22(23,24)25)21-28-17(12-33-21)8-9-19(31)27-16-6-2-4-14(10-16)20(26)32/h2-12H,1H3,(H2,26,32)(H,27,31)/b9-8+ |
| InChIKey | SVGXIMGHXQIBIQ-CMDGGOBGSA-N |
| XLogP | 4.60 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|