C20H22F3N3O2S — CID 18290514
(E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N-pentan-3-ylprop-2-enamide (PubChem CID 18290514) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N-pentan-3-ylprop-2-enamide.
| Compound Name | (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N-pentan-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 18290514 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-N-pentan-3-ylprop-2-enamide |
| SMILES | CCC(CC)NC(=O)/C=C/c1csc(N(C(C)=O)c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H22F3N3O2S/c1-4-15(5-2)24-18(28)10-9-16-12-29-19(25-16)26(13(3)27)17-8-6-7-14(11-17)20(21,22)23/h6-12,15H,4-5H2,1-3H3,(H,24,28)/b10-9+ |
| InChIKey | MXJBKSUNSHCRHP-MDZDMXLPSA-N |
| XLogP | 5.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|