C24H19F3N2O4S — CID 24656890
(4-propanoylphenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate (PubChem CID 24656890) has the molecular formula C24H19F3N2O4S and a molecular weight of 488.49 g/mol. Its IUPAC name is (4-propanoylphenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate.
| Compound Name | (4-propanoylphenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 24656890 |
| Molecular Formula | C24H19F3N2O4S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (4-propanoylphenyl) (E)-3-[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]prop-2-enoate |
| SMILES | CCC(=O)c1ccc(OC(=O)/C=C/c2csc(N(C(C)=O)c3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C24H19F3N2O4S/c1-3-21(31)16-7-10-20(11-8-16)33-22(32)12-9-18-14-34-23(28-18)29(15(2)30)19-6-4-5-17(13-19)24(25,26)27/h4-14H,3H2,1-2H3/b12-9+ |
| InChIKey | OZIYFJINCSKWJI-FMIVXFBMSA-N |
| XLogP | 6.06 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|