C25H25FN4O4S — CID 55751115
[4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate (PubChem CID 55751115) has the molecular formula C25H25FN4O4S and a molecular weight of 496.56 g/mol. Its IUPAC name is [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate.
| Compound Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 55751115 |
| Molecular Formula | C25H25FN4O4S |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate |
| SMILES | CC(=O)N(c1nc(C=CC(=O)Oc2ccc(N(C)C(=O)NC(C)C)cc2)cs1)c1ccccc1F |
| InChI | InChI=1S/C25H25FN4O4S/c1-16(2)27-24(33)29(4)19-10-12-20(13-11-19)34-23(32)14-9-18-15-35-25(28-18)30(17(3)31)22-8-6-5-7-21(22)26/h5-16H,1-4H3,(H,27,33) |
| InChIKey | MURMXNJLBNOZSV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|