C20H20FN3O4S — CID 8948430
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate (PubChem CID 8948430) has the molecular formula C20H20FN3O4S and a molecular weight of 417.46 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 8948430 |
| Molecular Formula | C20H20FN3O4S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]prop-2-enoate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)/C=C/c1csc(N(C(C)=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C20H20FN3O4S/c1-4-11-22-19(27)13(2)28-18(26)10-9-15-12-29-20(23-15)24(14(3)25)17-8-6-5-7-16(17)21/h4-10,12-13H,1,11H2,2-3H3,(H,22,27)/b10-9+/t13-/m1/s1 |
| InChIKey | AUDOEQMEVGUVMO-WTNCMQEWSA-N |
| XLogP | 3.21 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|