(4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid

C11H9N3O4S — CID 118656492

IUPAC(4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid
SMILESCc1csc(N(C(=O)O)c2ccc([N+](=O)[O-])cc2)n1
InChIInChI=1S/C11H9N3O4S/c1-7-6-19-10(12-7)13(11(15)16)8-2-4-9(5-3-8)14(17)18/h2-6H,1H3,(H,15,16)
InChIKeyNOSUPBWHXBJSRX-UHFFFAOYSA-N
MW279.28 g/mol
LogP3.18
Rot. Bonds3

About (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid

(4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid (PubChem CID 118656492) has the molecular formula C11H9N3O4S and a molecular weight of 279.28 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid.

Molecular Properties

Compound Name(4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid
PubChem CID118656492
Molecular FormulaC11H9N3O4S
Molecular Weight279.28 g/mol
Exact Mass279.03
IUPAC Name(4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid
SMILESCc1csc(N(C(=O)O)c2ccc([N+](=O)[O-])cc2)n1
InChIInChI=1S/C11H9N3O4S/c1-7-6-19-10(12-7)13(11(15)16)8-2-4-9(5-3-8)14(17)18/h2-6H,1H3,(H,15,16)
InChIKeyNOSUPBWHXBJSRX-UHFFFAOYSA-N
XLogP3.18
TPSA96.57 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.28
LogP ≤ 53.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid?
The IUPAC name of (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid (CID 118656492) is (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid.
What is the SMILES notation for (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid?
The canonical SMILES for (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid is Cc1csc(N(C(=O)O)c2ccc([N+](=O)[O-])cc2)n1.
What is the InChIKey of (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid?
The InChIKey is NOSUPBWHXBJSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O4S/c1-7-6-19-10(12-7)13(11(15)16)8-2-4-9(5-3-8)14(17)18/h2-6H,1H3,(H,15,16).
What are the key properties of (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid?
(4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid has a molecular weight of 279.28 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid is sourced from PubChem (CID 118656492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).