C11H9N3O4S — CID 118656492
(4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid (PubChem CID 118656492) has the molecular formula C11H9N3O4S and a molecular weight of 279.28 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid |
|---|---|
| PubChem CID | 118656492 |
| Molecular Formula | C11H9N3O4S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)-(4-nitrophenyl)carbamic acid |
| SMILES | Cc1csc(N(C(=O)O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C11H9N3O4S/c1-7-6-19-10(12-7)13(11(15)16)8-2-4-9(5-3-8)14(17)18/h2-6H,1H3,(H,15,16) |
| InChIKey | NOSUPBWHXBJSRX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|