C14H15ClN2OS — CID 62727733
3-chloro-2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpropanamide (PubChem CID 62727733) has the molecular formula C14H15ClN2OS and a molecular weight of 294.81 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpropanamide.
| Compound Name | 3-chloro-2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 62727733 |
| Molecular Formula | C14H15ClN2OS |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 3-chloro-2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpropanamide |
| SMILES | Cc1csc(N(C(=O)C(C)CCl)c2ccccc2)n1 |
| InChI | InChI=1S/C14H15ClN2OS/c1-10(8-15)13(18)17(12-6-4-3-5-7-12)14-16-11(2)9-19-14/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | XNAJIWQPXHWENM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|