C18H17ClN4OS — CID 99807622
2-chloro-6-(dimethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-4-carboxamide (PubChem CID 99807622) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is 2-chloro-6-(dimethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(dimethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 99807622 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-chloro-6-(dimethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-4-carboxamide |
| SMILES | Cc1csc(N(C(=O)c2cc(Cl)nc(N(C)C)c2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H17ClN4OS/c1-12-11-25-18(20-12)23(14-7-5-4-6-8-14)17(24)13-9-15(19)21-16(10-13)22(2)3/h4-11H,1-3H3 |
| InChIKey | SZSRFZMNEKKUTM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|