C16H12ClN3OS — CID 52895835
2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-3-carboxamide (PubChem CID 52895835) has the molecular formula C16H12ClN3OS and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 52895835 |
| Molecular Formula | C16H12ClN3OS |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylpyridine-3-carboxamide |
| SMILES | Cc1csc(N(C(=O)c2cccnc2Cl)c2ccccc2)n1 |
| InChI | InChI=1S/C16H12ClN3OS/c1-11-10-22-16(19-11)20(12-6-3-2-4-7-12)15(21)13-8-5-9-18-14(13)17/h2-10H,1H3 |
| InChIKey | VMUGJSOAYWLUGH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|