C14H12Cl2N2OS — CID 78778238
2,2-dichloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylcyclopropane-1-carboxamide (PubChem CID 78778238) has the molecular formula C14H12Cl2N2OS and a molecular weight of 327.24 g/mol. Its IUPAC name is 2,2-dichloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78778238 |
| Molecular Formula | C14H12Cl2N2OS |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 2,2-dichloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylcyclopropane-1-carboxamide |
| SMILES | Cc1csc(N(C(=O)C2CC2(Cl)Cl)c2ccccc2)n1 |
| InChI | InChI=1S/C14H12Cl2N2OS/c1-9-8-20-13(17-9)18(10-5-3-2-4-6-10)12(19)11-7-14(11,15)16/h2-6,8,11H,7H2,1H3 |
| InChIKey | RSJXTXFIUHRCKD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|