C24H34N4O3 — CID 71053433
(5R,8aR)-N-benzyl-7-cyclopentyl-2-methyl-4,6-dioxo-5-propyl-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide (PubChem CID 71053433) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is (5R,8aR)-N-benzyl-7-cyclopentyl-2-methyl-4,6-dioxo-5-propyl-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide.
| Compound Name | (5R,8aR)-N-benzyl-7-cyclopentyl-2-methyl-4,6-dioxo-5-propyl-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide |
|---|---|
| PubChem CID | 71053433 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (5R,8aR)-N-benzyl-7-cyclopentyl-2-methyl-4,6-dioxo-5-propyl-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide |
| SMILES | CCC[C@H]1C(=O)N(C2CCCC2)C[C@H]2C1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H34N4O3/c1-3-9-19-22-20(15-27(23(19)30)18-12-7-8-13-18)28(26(2)16-21(22)29)24(31)25-14-17-10-5-4-6-11-17/h4-6,10-11,18-20,22H,3,7-9,12-16H2,1-2H3,(H,25,31)/t19-,20+,22?/m1/s1 |
| InChIKey | PXBOSACOJRUPSL-MFCMXAAESA-N |
| XLogP | 2.81 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |