C27H33FN4O3 — CID 71053517
(5R,8aR)-7-benzyl-5-butan-2-yl-N-[(4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide (PubChem CID 71053517) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is (5R,8aR)-7-benzyl-5-butan-2-yl-N-[(4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide.
| Compound Name | (5R,8aR)-7-benzyl-5-butan-2-yl-N-[(4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide |
|---|---|
| PubChem CID | 71053517 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (5R,8aR)-7-benzyl-5-butan-2-yl-N-[(4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-4a,5,8,8a-tetrahydro-3H-pyrido[3,4-c]pyridazine-1-carboxamide |
| SMILES | CCC(C)[C@H]1C(=O)N(Cc2ccccc2)C[C@H]2C1C(=O)CN(C)N2C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H33FN4O3/c1-4-18(2)24-25-22(16-31(26(24)34)15-20-8-6-5-7-9-20)32(30(3)17-23(25)33)27(35)29-14-19-10-12-21(28)13-11-19/h5-13,18,22,24-25H,4,14-17H2,1-3H3,(H,29,35)/t18?,22-,24+,25?/m0/s1 |
| InChIKey | FILMJZKYQTUELO-XOFKQJQBSA-N |
| XLogP | 3.46 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |