C24H25NO5 — CID 71055944
(1R,2E)-2-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropylidene]cyclopentane-1-carboxylic acid (PubChem CID 71055944) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is (1R,2E)-2-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropylidene]cyclopentane-1-carboxylic acid.
| Compound Name | (1R,2E)-2-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropylidene]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 71055944 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (1R,2E)-2-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropylidene]cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@H](/C=C1\CCC[C@H]1C(=O)O)CO)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H25NO5/c26-13-16(12-15-6-5-11-17(15)23(27)28)25-24(29)30-14-22-20-9-3-1-7-18(20)19-8-2-4-10-21(19)22/h1-4,7-10,12,16-17,22,26H,5-6,11,13-14H2,(H,25,29)(H,27,28)/b15-12+/t16-,17-/m1/s1 |
| InChIKey | UUSITZWVTZSBAJ-OMYPGEHRSA-N |
| XLogP | 3.70 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|