About [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol
[4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol (PubChem CID 71058174) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol |
| PubChem CID | 71058174 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol |
| SMILES | CCc1nc(C)nc(-c2ccc(CO)cc2)n1 |
| InChI | InChI=1S/C13H15N3O/c1-3-12-14-9(2)15-13(16-12)11-6-4-10(8-17)5-7-11/h4-7,17H,3,8H2,1-2H3 |
| InChIKey | AFJQCUVBZAHZHI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol?
The IUPAC name of [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol (CID 71058174) is [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol.
What is the SMILES notation for [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol?
The canonical SMILES for [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol is CCc1nc(C)nc(-c2ccc(CO)cc2)n1.
What is the InChIKey of [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol?
The InChIKey is AFJQCUVBZAHZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O/c1-3-12-14-9(2)15-13(16-12)11-6-4-10(8-17)5-7-11/h4-7,17H,3,8H2,1-2H3.
What are the key properties of [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol?
[4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol has a molecular weight of 229.28 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)phenyl]methanol is sourced from PubChem (CID 71058174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).