C17H18FNO5S — CID 71060519
[(1R)-1-(2-fluorophenyl)-2-sulfamoylethyl] 2-methoxy-2-phenylacetate (PubChem CID 71060519) has the molecular formula C17H18FNO5S and a molecular weight of 367.40 g/mol. Its IUPAC name is [(1R)-1-(2-fluorophenyl)-2-sulfamoylethyl] 2-methoxy-2-phenylacetate.
| Compound Name | [(1R)-1-(2-fluorophenyl)-2-sulfamoylethyl] 2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 71060519 |
| Molecular Formula | C17H18FNO5S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [(1R)-1-(2-fluorophenyl)-2-sulfamoylethyl] 2-methoxy-2-phenylacetate |
| SMILES | COC(C(=O)O[C@@H](CS(N)(=O)=O)c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C17H18FNO5S/c1-23-16(12-7-3-2-4-8-12)17(20)24-15(11-25(19,21)22)13-9-5-6-10-14(13)18/h2-10,15-16H,11H2,1H3,(H2,19,21,22)/t15-,16?/m0/s1 |
| InChIKey | HWVKJABYGOMVBU-VYRBHSGPSA-N |
| XLogP | 2.09 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |