C16H20N2O5S — CID 71062971
[(7aR)-2-(dimethylamino)-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-yl] benzoate (PubChem CID 71062971) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is [(7aR)-2-(dimethylamino)-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-yl] benzoate.
| Compound Name | [(7aR)-2-(dimethylamino)-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-yl] benzoate |
|---|---|
| PubChem CID | 71062971 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [(7aR)-2-(dimethylamino)-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-yl] benzoate |
| SMILES | CN(C)C1=N[C@H]2C(OC(CO)C(OC(=O)c3ccccc3)C2O)S1 |
| InChI | InChI=1S/C16H20N2O5S/c1-18(2)16-17-11-12(20)13(10(8-19)22-15(11)24-16)23-14(21)9-6-4-3-5-7-9/h3-7,10-13,15,19-20H,8H2,1-2H3/t10?,11-,12?,13?,15?/m1/s1 |
| InChIKey | PWRKNSIDVBLTBG-VJYUNANBSA-N |
| XLogP | 0.32 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |