C19H23NO7S — CID 71152556
tert-butyl (3aR,5R,6S,7R,7aR)-6-benzoyloxy-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-2-carboxylate (PubChem CID 71152556) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is tert-butyl (3aR,5R,6S,7R,7aR)-6-benzoyloxy-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-2-carboxylate.
| Compound Name | tert-butyl (3aR,5R,6S,7R,7aR)-6-benzoyloxy-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-2-carboxylate |
|---|---|
| PubChem CID | 71152556 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | tert-butyl (3aR,5R,6S,7R,7aR)-6-benzoyloxy-7-hydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=N[C@@H]2[C@@H](O)[C@H](OC(=O)c3ccccc3)[C@@H](CO)O[C@@H]2S1 |
| InChI | InChI=1S/C19H23NO7S/c1-19(2,3)27-17(24)15-20-12-13(22)14(11(9-21)25-18(12)28-15)26-16(23)10-7-5-4-6-8-10/h4-8,11-14,18,21-22H,9H2,1-3H3/t11-,12-,13-,14-,18-/m1/s1 |
| InChIKey | CYNPNLZGNSLZBS-KMYWOXPZSA-N |
| XLogP | 1.15 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |