C33H45N9O — CID 71067071
1-[4-(dimethylamino)phenyl]-3-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]urea (PubChem CID 71067071) has the molecular formula C33H45N9O and a molecular weight of 583.79 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]urea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 71067071 |
| Molecular Formula | C33H45N9O |
| Molecular Weight | 583.79 g/mol |
| Exact Mass | 583.37 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]urea |
| SMILES | CN1CCN(C2=CC=CC3=NC(CN(C)[C@H]4CCCc5cccnc54)C(CNC(=O)Nc4ccc(N(C)C)cc4)N23)CC1 |
| InChI | InChI=1S/C33H45N9O/c1-38(2)26-15-13-25(14-16-26)36-33(43)35-22-29-27(23-40(4)28-10-5-8-24-9-7-17-34-32(24)28)37-30-11-6-12-31(42(29)30)41-20-18-39(3)19-21-41/h6-7,9,11-17,27-29H,5,8,10,18-23H2,1-4H3,(H2,35,36,43)/t27?,28-,29?/m0/s1 |
| InChIKey | KAHBXZVAMGUHHY-VJPAEBCTSA-N |
| XLogP | 3.39 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|