C31H40N8O — CID 71067095
1-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]-3-phenylurea (PubChem CID 71067095) has the molecular formula C31H40N8O and a molecular weight of 540.72 g/mol. Its IUPAC name is 1-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 71067095 |
| Molecular Formula | C31H40N8O |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | 1-[[5-(4-methylpiperazin-1-yl)-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]methyl]-3-phenylurea |
| SMILES | CN1CCN(C2=CC=CC3=NC(CN(C)[C@H]4CCCc5cccnc54)C(CNC(=O)Nc4ccccc4)N23)CC1 |
| InChI | InChI=1S/C31H40N8O/c1-36-17-19-38(20-18-36)29-15-7-14-28-35-25(22-37(2)26-13-6-9-23-10-8-16-32-30(23)26)27(39(28)29)21-33-31(40)34-24-11-4-3-5-12-24/h3-5,7-8,10-12,14-16,25-27H,6,9,13,17-22H2,1-2H3,(H2,33,34,40)/t25?,26-,27?/m0/s1 |
| InChIKey | NUCQWCWQCVNYAG-QLLQDVQFSA-N |
| XLogP | 3.32 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |