C29H41N7 — CID 143518633
5-[4-(dimethylamino)piperidin-1-yl]-3-methyl-2-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2H-imidazo[1,2-a]pyridine-3-carbonitrile (PubChem CID 143518633) has the molecular formula C29H41N7 and a molecular weight of 487.70 g/mol. Its IUPAC name is 5-[4-(dimethylamino)piperidin-1-yl]-3-methyl-2-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2H-imidazo[1,2-a]pyridine-3-carbonitrile.
| Compound Name | 5-[4-(dimethylamino)piperidin-1-yl]-3-methyl-2-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2H-imidazo[1,2-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143518633 |
| Molecular Formula | C29H41N7 |
| Molecular Weight | 487.70 g/mol |
| Exact Mass | 487.34 |
| IUPAC Name | 5-[4-(dimethylamino)piperidin-1-yl]-3-methyl-2-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-2H-imidazo[1,2-a]pyridine-3-carbonitrile |
| SMILES | CC(C)N(CC1N=C2C=CC=C(N3CCC(N(C)C)CC3)N2C1(C)C#N)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C29H41N7/c1-21(2)35(24-11-6-9-22-10-8-16-31-28(22)24)19-25-29(3,20-30)36-26(32-25)12-7-13-27(36)34-17-14-23(15-18-34)33(4)5/h7-8,10,12-13,16,21,23-25H,6,9,11,14-15,17-19H2,1-5H3/t24-,25?,29?/m0/s1 |
| InChIKey | UXHGRXDASLSBLN-KOKAMKNVSA-N |
| XLogP | 3.97 |
| TPSA | 62.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.70 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |