C27H40N6O — CID 143196465
[3-[(1Z)-1-[3-(dimethylamino)pyrrolidin-1-yl]buta-1,3-dienyl]-5-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]imidazol-4-yl]methanol (PubChem CID 143196465) has the molecular formula C27H40N6O and a molecular weight of 464.66 g/mol. Its IUPAC name is [3-[(1Z)-1-[3-(dimethylamino)pyrrolidin-1-yl]buta-1,3-dienyl]-5-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]imidazol-4-yl]methanol.
| Compound Name | [3-[(1Z)-1-[3-(dimethylamino)pyrrolidin-1-yl]buta-1,3-dienyl]-5-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 143196465 |
| Molecular Formula | C27H40N6O |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | [3-[(1Z)-1-[3-(dimethylamino)pyrrolidin-1-yl]buta-1,3-dienyl]-5-[[propan-2-yl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]imidazol-4-yl]methanol |
| SMILES | C=C/C=C(/N1CCC(N(C)C)C1)n1cnc(CN(C(C)C)[C@H]2CCCc3cccnc32)c1CO |
| InChI | InChI=1S/C27H40N6O/c1-6-9-26(31-15-13-22(16-31)30(4)5)33-19-29-23(25(33)18-34)17-32(20(2)3)24-12-7-10-21-11-8-14-28-27(21)24/h6,8-9,11,14,19-20,22,24,34H,1,7,10,12-13,15-18H2,2-5H3/b26-9-/t22?,24-/m0/s1 |
| InChIKey | OMUHRPWBQSMJAD-GYUCKNRJSA-N |
| XLogP | 3.68 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|