C22H22NO5S- — CID 71070540
4-[[(2S)-2,3-dihydroxy-1-(4-phenylmethoxyphenyl)propyl]amino]benzenesulfinate (PubChem CID 71070540) has the molecular formula C22H22NO5S- and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[[(2S)-2,3-dihydroxy-1-(4-phenylmethoxyphenyl)propyl]amino]benzenesulfinate.
| Compound Name | 4-[[(2S)-2,3-dihydroxy-1-(4-phenylmethoxyphenyl)propyl]amino]benzenesulfinate |
|---|---|
| PubChem CID | 71070540 |
| Molecular Formula | C22H22NO5S- |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[[(2S)-2,3-dihydroxy-1-(4-phenylmethoxyphenyl)propyl]amino]benzenesulfinate |
| SMILES | O=S([O-])c1ccc(NC(c2ccc(OCc3ccccc3)cc2)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C22H23NO5S/c24-14-21(25)22(23-18-8-12-20(13-9-18)29(26)27)17-6-10-19(11-7-17)28-15-16-4-2-1-3-5-16/h1-13,21-25H,14-15H2,(H,26,27)/p-1/t21-,22?/m1/s1 |
| InChIKey | FSVDXKONIGXPIN-ZMFCMNQTSA-M |
| XLogP | 3.01 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|