C25H29NO3 — CID 71070702
N-[1-(hydroxymethyl)-4-tricyclo[5.3.1.03,9]undecanyl]-3-phenoxybenzamide (PubChem CID 71070702) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)-4-tricyclo[5.3.1.03,9]undecanyl]-3-phenoxybenzamide.
| Compound Name | N-[1-(hydroxymethyl)-4-tricyclo[5.3.1.03,9]undecanyl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 71070702 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[1-(hydroxymethyl)-4-tricyclo[5.3.1.03,9]undecanyl]-3-phenoxybenzamide |
| SMILES | O=C(NC1CCC2CC3CC(CO)(C2)CC31)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H29NO3/c27-16-25-13-17-9-10-23(22(15-25)19(11-17)14-25)26-24(28)18-5-4-8-21(12-18)29-20-6-2-1-3-7-20/h1-8,12,17,19,22-23,27H,9-11,13-16H2,(H,26,28) |
| InChIKey | RFZNUOPPQCJEKI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |