C21H22ClNO2 — CID 71070781
methyl 2-[6-chloro-2,5-dimethyl-1-[(3-methylphenyl)methyl]indol-3-yl]acetate (PubChem CID 71070781) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is methyl 2-[6-chloro-2,5-dimethyl-1-[(3-methylphenyl)methyl]indol-3-yl]acetate.
| Compound Name | methyl 2-[6-chloro-2,5-dimethyl-1-[(3-methylphenyl)methyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 71070781 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 2-[6-chloro-2,5-dimethyl-1-[(3-methylphenyl)methyl]indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)n(Cc2cccc(C)c2)c2cc(Cl)c(C)cc12 |
| InChI | InChI=1S/C21H22ClNO2/c1-13-6-5-7-16(8-13)12-23-15(3)17(10-21(24)25-4)18-9-14(2)19(22)11-20(18)23/h5-9,11H,10,12H2,1-4H3 |
| InChIKey | QSTMBRMPMUGLBD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|