C12H17N3 — CID 71072571
trans-(1R,2R)-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine (PubChem CID 71072571) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is trans-(1R,2R)-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine |
|---|---|
| PubChem CID | 71072571 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | trans-(1R,2R)-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@H]1/N=C/c1ccccn1 |
| InChI | InChI=1S/C12H17N3/c13-11-6-1-2-7-12(11)15-9-10-5-3-4-8-14-10/h3-5,8-9,11-12H,1-2,6-7,13H2/b15-9+/t11-,12-/m1/s1 |
| InChIKey | KQBWMNORGFLPLD-ZOPJJOQRSA-N |
| XLogP | 1.77 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|