C19H24N4O — CID 139156438
trans-(1R,2R)-N-[(S)-methoxy(pyridin-2-yl)methyl]-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine (PubChem CID 139156438) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(S)-methoxy(pyridin-2-yl)methyl]-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-N-[(S)-methoxy(pyridin-2-yl)methyl]-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine |
|---|---|
| PubChem CID | 139156438 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | trans-(1R,2R)-N-[(S)-methoxy(pyridin-2-yl)methyl]-2-(pyridin-2-ylmethylideneamino)cyclohexan-1-amine |
| SMILES | CO[C@H](N[C@@H]1CCCC[C@H]1/N=C/c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C19H24N4O/c1-24-19(18-11-5-7-13-21-18)23-17-10-3-2-9-16(17)22-14-15-8-4-6-12-20-15/h4-8,11-14,16-17,19,23H,2-3,9-10H2,1H3/b22-14+/t16-,17-,19+/m1/s1 |
| InChIKey | DCJWEGKHKWSWBF-RESBBRTPSA-N |
| XLogP | 3.14 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|