C18H20N4 — CID 122530328
cis-(1S,2S)-3,4-bis(pyridin-2-ylmethylidene)cyclohexane-1,2-diamine (PubChem CID 122530328) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is cis-(1S,2S)-3,4-bis(pyridin-2-ylmethylidene)cyclohexane-1,2-diamine.
| Compound Name | cis-(1S,2S)-3,4-bis(pyridin-2-ylmethylidene)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 122530328 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | cis-(1S,2S)-3,4-bis(pyridin-2-ylmethylidene)cyclohexane-1,2-diamine |
| SMILES | N[C@H]1CCC(=Cc2ccccn2)C(=Cc2ccccn2)[C@@H]1N |
| InChI | InChI=1S/C18H20N4/c19-17-8-7-13(11-14-5-1-3-9-21-14)16(18(17)20)12-15-6-2-4-10-22-15/h1-6,9-12,17-18H,7-8,19-20H2/t17-,18-/m0/s1 |
| InChIKey | PBHXXKYMDXPPHR-ROUUACIJSA-N |
| XLogP | 2.39 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |