C11H12N4O — CID 71072606
(E)-4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)but-3-en-2-one (PubChem CID 71072606) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is (E)-4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)but-3-en-2-one.
| Compound Name | (E)-4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 71072606 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (E)-4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cn(C)c2ncnc(N)c12 |
| InChI | InChI=1S/C11H12N4O/c1-7(16)3-4-8-5-15(2)11-9(8)10(12)13-6-14-11/h3-6H,1-2H3,(H2,12,13,14)/b4-3+ |
| InChIKey | GIYROTAOXRTQDW-ONEGZZNKSA-N |
| XLogP | 1.15 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|