C33H29BrN6O — CID 71074738
N-[1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide (PubChem CID 71074738) has the molecular formula C33H29BrN6O and a molecular weight of 605.54 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71074738 |
| Molecular Formula | C33H29BrN6O |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | N-[1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c2ccc(C(=O)NC(C)c3cccc(Br)c3)cc12 |
| InChI | InChI=1S/C33H29BrN6O/c1-20-22(3)40(19-23-11-13-24(14-12-23)28-9-4-5-10-29(28)32-36-38-39-37-32)31-16-15-26(18-30(20)31)33(41)35-21(2)25-7-6-8-27(34)17-25/h4-18,21H,19H2,1-3H3,(H,35,41)(H,36,37,38,39) |
| InChIKey | KZEOTEDWPLTTJG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|