C18H22N4O4 — CID 71076382
tert-butyl N-[(5S)-7-hydroxy-2-(3-methylphenyl)-6-oxo-4,5-dihydropyrazolo[3,4-b]pyridin-5-yl]carbamate (PubChem CID 71076382) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is tert-butyl N-[(5S)-7-hydroxy-2-(3-methylphenyl)-6-oxo-4,5-dihydropyrazolo[3,4-b]pyridin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-7-hydroxy-2-(3-methylphenyl)-6-oxo-4,5-dihydropyrazolo[3,4-b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 71076382 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | tert-butyl N-[(5S)-7-hydroxy-2-(3-methylphenyl)-6-oxo-4,5-dihydropyrazolo[3,4-b]pyridin-5-yl]carbamate |
| SMILES | Cc1cccc(-n2cc3c(n2)N(O)C(=O)[C@@H](NC(=O)OC(C)(C)C)C3)c1 |
| InChI | InChI=1S/C18H22N4O4/c1-11-6-5-7-13(8-11)21-10-12-9-14(16(23)22(25)15(12)20-21)19-17(24)26-18(2,3)4/h5-8,10,14,25H,9H2,1-4H3,(H,19,24)/t14-/m0/s1 |
| InChIKey | HONIJCGEJXUSBY-AWEZNQCLSA-N |
| XLogP | 2.35 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|