C22H30N2O6 — CID 7108024
(E)-3-[(3R,4R)-3,5-dihydroxy-2,2-dimethyl-4-morpholin-4-yl-3,4-dihydrochromen-6-yl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 7108024) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is (E)-3-[(3R,4R)-3,5-dihydroxy-2,2-dimethyl-4-morpholin-4-yl-3,4-dihydrochromen-6-yl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-[(3R,4R)-3,5-dihydroxy-2,2-dimethyl-4-morpholin-4-yl-3,4-dihydrochromen-6-yl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 7108024 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (E)-3-[(3R,4R)-3,5-dihydroxy-2,2-dimethyl-4-morpholin-4-yl-3,4-dihydrochromen-6-yl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | CC1(C)Oc2ccc(/C=C/C(=O)N3CCOCC3)c(O)c2[C@@H](N2CCOCC2)[C@H]1O |
| InChI | InChI=1S/C22H30N2O6/c1-22(2)21(27)19(24-9-13-29-14-10-24)18-16(30-22)5-3-15(20(18)26)4-6-17(25)23-7-11-28-12-8-23/h3-6,19,21,26-27H,7-14H2,1-2H3/b6-4+/t19-,21-/m1/s1 |
| InChIKey | AMAWPOMGKCECTH-KPMVZVDBSA-N |
| XLogP | 1.17 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|