C27H39N2O7+ — CID 7567054
[(3S,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] 3-methylbutanoate (PubChem CID 7567054) has the molecular formula C27H39N2O7+ and a molecular weight of 503.62 g/mol. Its IUPAC name is [(3S,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] 3-methylbutanoate.
| Compound Name | [(3S,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 7567054 |
| Molecular Formula | C27H39N2O7+ |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | [(3S,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@H]1[C@@H]([NH+]2CCOCC2)c2c(ccc(/C=C/C(=O)N3CCOCC3)c2O)OC1(C)C |
| InChI | InChI=1S/C27H38N2O7/c1-18(2)17-22(31)35-26-24(29-11-15-34-16-12-29)23-20(36-27(26,3)4)7-5-19(25(23)32)6-8-21(30)28-9-13-33-14-10-28/h5-8,18,24,26,32H,9-17H2,1-4H3/p+1/b8-6+/t24-,26-/m0/s1 |
| InChIKey | HABFVMRKJUPSNL-PQGAWXBYSA-O |
| XLogP | 1.35 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|