C24H22N2O4 — CID 71085679
N-(2,4-diphenyl-2,3-dihydro-1,3-oxazol-5-yl)-3,4-dimethoxybenzamide (PubChem CID 71085679) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-(2,4-diphenyl-2,3-dihydro-1,3-oxazol-5-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2,4-diphenyl-2,3-dihydro-1,3-oxazol-5-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 71085679 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-(2,4-diphenyl-2,3-dihydro-1,3-oxazol-5-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2=C(c3ccccc3)NC(c3ccccc3)O2)cc1OC |
| InChI | InChI=1S/C24H22N2O4/c1-28-19-14-13-18(15-20(19)29-2)22(27)26-24-21(16-9-5-3-6-10-16)25-23(30-24)17-11-7-4-8-12-17/h3-15,23,25H,1-2H3,(H,26,27) |
| InChIKey | CVTOUDBGQKBOBJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |