C19H19ClN4O3 — CID 71086858
1-(2-chloro-4-morpholin-2-ylphenyl)-3-(5-cyano-2-methoxyphenyl)urea (PubChem CID 71086858) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 1-(2-chloro-4-morpholin-2-ylphenyl)-3-(5-cyano-2-methoxyphenyl)urea.
| Compound Name | 1-(2-chloro-4-morpholin-2-ylphenyl)-3-(5-cyano-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 71086858 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-(2-chloro-4-morpholin-2-ylphenyl)-3-(5-cyano-2-methoxyphenyl)urea |
| SMILES | COc1ccc(C#N)cc1NC(=O)Nc1ccc(C2CNCCO2)cc1Cl |
| InChI | InChI=1S/C19H19ClN4O3/c1-26-17-5-2-12(10-21)8-16(17)24-19(25)23-15-4-3-13(9-14(15)20)18-11-22-6-7-27-18/h2-5,8-9,18,22H,6-7,11H2,1H3,(H2,23,24,25) |
| InChIKey | UADAZOLRCDZCAL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |