C16H15BrF3N5O2 — CID 71087036
1-(2-bromo-4-morpholin-2-ylphenyl)-3-[2-(trifluoromethyl)pyrimidin-5-yl]urea (PubChem CID 71087036) has the molecular formula C16H15BrF3N5O2 and a molecular weight of 446.23 g/mol. Its IUPAC name is 1-(2-bromo-4-morpholin-2-ylphenyl)-3-[2-(trifluoromethyl)pyrimidin-5-yl]urea.
| Compound Name | 1-(2-bromo-4-morpholin-2-ylphenyl)-3-[2-(trifluoromethyl)pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 71087036 |
| Molecular Formula | C16H15BrF3N5O2 |
| Molecular Weight | 446.23 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 1-(2-bromo-4-morpholin-2-ylphenyl)-3-[2-(trifluoromethyl)pyrimidin-5-yl]urea |
| SMILES | O=C(Nc1cnc(C(F)(F)F)nc1)Nc1ccc(C2CNCCO2)cc1Br |
| InChI | InChI=1S/C16H15BrF3N5O2/c17-11-5-9(13-8-21-3-4-27-13)1-2-12(11)25-15(26)24-10-6-22-14(23-7-10)16(18,19)20/h1-2,5-7,13,21H,3-4,8H2,(H2,24,25,26) |
| InChIKey | TVIVIBSWEOBVBK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |