About 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride
1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride (PubChem CID 71090542) has the molecular formula C11H18ClN3O3
and a molecular weight of 275.74 g/mol. Its IUPAC name is 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride |
| PubChem CID | 71090542 |
| Molecular Formula | C11H18ClN3O3 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride |
| SMILES | CC(C)(C(=O)Oc1nnco1)N1CCCCC1.Cl |
| InChI | InChI=1S/C11H17N3O3.ClH/c1-11(2,14-6-4-3-5-7-14)9(15)17-10-13-12-8-16-10;/h8H,3-7H2,1-2H3;1H |
| InChIKey | XDVHGVDNZQJROX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride?
The IUPAC name of 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride (CID 71090542) is 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride.
What is the SMILES notation for 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride?
The canonical SMILES for 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride is CC(C)(C(=O)Oc1nnco1)N1CCCCC1.Cl.
What is the InChIKey of 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride?
The InChIKey is XDVHGVDNZQJROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3.ClH/c1-11(2,14-6-4-3-5-7-14)9(15)17-10-13-12-8-16-10;/h8H,3-7H2,1-2H3;1H.
What are the key properties of 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride?
1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride has a molecular weight of 275.74 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-oxadiazol-2-yl 2-methyl-2-piperidin-1-ylpropanoate;hydrochloride is sourced from PubChem (CID 71090542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).