C19H26FN3 — CID 71091015
1-N-(4-aminobutyl)-2-N-(2-fluoro-4-methylphenyl)-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 71091015) has the molecular formula C19H26FN3 and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-N-(4-aminobutyl)-2-N-(2-fluoro-4-methylphenyl)-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 1-N-(4-aminobutyl)-2-N-(2-fluoro-4-methylphenyl)-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 71091015 |
| Molecular Formula | C19H26FN3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1-N-(4-aminobutyl)-2-N-(2-fluoro-4-methylphenyl)-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | Cc1ccc(N(C)c2ccccc2N(C)CCCCN)c(F)c1 |
| InChI | InChI=1S/C19H26FN3/c1-15-10-11-17(16(20)14-15)23(3)19-9-5-4-8-18(19)22(2)13-7-6-12-21/h4-5,8-11,14H,6-7,12-13,21H2,1-3H3 |
| InChIKey | UXDGKDRKMJGHJP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|